About 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride
2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride (PubChem CID 142636557) has the molecular formula C24H35Cl2N3O2
and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride |
| PubChem CID | 142636557 |
| Molecular Formula | C24H35Cl2N3O2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride |
| SMILES | CCN(CC)C(=O)c1cccc(N2CCN(CCO)CC2)c1Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C24H33N3O2.2ClH/c1-3-26(4-2)24(29)21-11-8-12-23(22(21)19-20-9-6-5-7-10-20)27-15-13-25(14-16-27)17-18-28;;/h5-12,28H,3-4,13-19H2,1-2H3;2*1H |
| InChIKey | FMUFNQUMRQVHHW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride?
The IUPAC name of 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride (CID 142636557) is 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride.
What is the SMILES notation for 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride?
The canonical SMILES for 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride is CCN(CC)C(=O)c1cccc(N2CCN(CCO)CC2)c1Cc1ccccc1.Cl.Cl.
What is the InChIKey of 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride?
The InChIKey is FMUFNQUMRQVHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3O2.2ClH/c1-3-26(4-2)24(29)21-11-8-12-23(22(21)19-20-9-6-5-7-10-20)27-15-13-25(14-16-27)17-18-28;;/h5-12,28H,3-4,13-19H2,1-2H3;2*1H.
What are the key properties of 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride?
2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride has a molecular weight of 468.47 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N,N-diethyl-3-[4-(2-hydroxyethyl)piperazin-1-yl]benzamide;dihydrochloride is sourced from PubChem (CID 142636557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).