C15H10F2N2O2 — CID 142637138
4-[5-(2,4-difluorophenyl)-1H-pyrazol-3-yl]benzene-1,2-diol (PubChem CID 142637138) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-[5-(2,4-difluorophenyl)-1H-pyrazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-(2,4-difluorophenyl)-1H-pyrazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 142637138 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[5-(2,4-difluorophenyl)-1H-pyrazol-3-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2cc(-c3ccc(F)cc3F)[nH]n2)cc1O |
| InChI | InChI=1S/C15H10F2N2O2/c16-9-2-3-10(11(17)6-9)13-7-12(18-19-13)8-1-4-14(20)15(21)5-8/h1-7,20-21H,(H,18,19) |
| InChIKey | YWTZHGUQXWNSPL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|