About 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine
1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine (PubChem CID 142637336) has the molecular formula C16H15BrN2O
and a molecular weight of 331.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine |
| PubChem CID | 142637336 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine |
| SMILES | COc1ccc2c(c1)C(c1ccc(Br)cc1)=NNCC2 |
| InChI | InChI=1S/C16H15BrN2O/c1-20-14-7-4-11-8-9-18-19-16(15(11)10-14)12-2-5-13(17)6-3-12/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | IJEHPLQEYBGTCY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine?
The IUPAC name of 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine (CID 142637336) is 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine.
What is the SMILES notation for 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine?
The canonical SMILES for 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine is COc1ccc2c(c1)C(c1ccc(Br)cc1)=NNCC2.
What is the InChIKey of 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine?
The InChIKey is IJEHPLQEYBGTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN2O/c1-20-14-7-4-11-8-9-18-19-16(15(11)10-14)12-2-5-13(17)6-3-12/h2-7,10,18H,8-9H2,1H3.
What are the key properties of 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine?
1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine has a molecular weight of 331.21 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-8-methoxy-4,5-dihydro-3H-2,3-benzodiazepine is sourced from PubChem (CID 142637336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).