C20H18Cl2N4O4S2 — CID 142637369
2-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide (PubChem CID 142637369) has the molecular formula C20H18Cl2N4O4S2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide.
| Compound Name | 2-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 142637369 |
| Molecular Formula | C20H18Cl2N4O4S2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 2-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(O)cc1CN1CC[C@H](NS(=O)(=O)c2cc3c(Cl)cc(Cl)cc3s2)C1=O |
| InChI | InChI=1S/C20H18Cl2N4O4S2/c21-11-6-15(22)14-8-18(31-17(14)7-11)32(29,30)25-16-3-4-26(20(16)28)9-10-5-12(27)1-2-13(10)19(23)24/h1-2,5-8,16,25,27H,3-4,9H2,(H3,23,24)/t16-/m0/s1 |
| InChIKey | LSRDZSLREIPGOF-INIZCTEOSA-N |
| XLogP | 3.28 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|