About 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride
4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride (PubChem CID 142637441) has the molecular formula C14H23ClN6O3
and a molecular weight of 358.83 g/mol. Its IUPAC name is 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride |
| PubChem CID | 142637441 |
| Molecular Formula | C14H23ClN6O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)OCCCCNc1nc2nc[nH]c2c(=O)[nH]1.Cl |
| InChI | InChI=1S/C14H22N6O3.ClH/c1-8(2)9(15)13(22)23-6-4-3-5-16-14-19-11-10(12(21)20-14)17-7-18-11;/h7-9H,3-6,15H2,1-2H3,(H3,16,17,18,19,20,21);1H/t9-;/m0./s1 |
| InChIKey | PUZFYCCSXJVREA-FVGYRXGTSA-N |
| XLogP | 0.79 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride?
The IUPAC name of 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride (CID 142637441) is 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride.
What is the SMILES notation for 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride?
The canonical SMILES for 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride is CC(C)[C@H](N)C(=O)OCCCCNc1nc2nc[nH]c2c(=O)[nH]1.Cl.
What is the InChIKey of 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride?
The InChIKey is PUZFYCCSXJVREA-FVGYRXGTSA-N. The full InChI is InChI=1S/C14H22N6O3.ClH/c1-8(2)9(15)13(22)23-6-4-3-5-16-14-19-11-10(12(21)20-14)17-7-18-11;/h7-9H,3-6,15H2,1-2H3,(H3,16,17,18,19,20,21);1H/t9-;/m0./s1.
What are the key properties of 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride?
4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride has a molecular weight of 358.83 g/mol, XLogP of 0.79, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-oxo-1,7-dihydropurin-2-yl)amino]butyl (2S)-2-amino-3-methylbutanoate;hydrochloride is sourced from PubChem (CID 142637441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).