C27H27ClN2O — CID 142637516
3-[[1-[[(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperidin-4-yl]methyl]-1H-pyridin-2-one (PubChem CID 142637516) has the molecular formula C27H27ClN2O and a molecular weight of 430.98 g/mol. Its IUPAC name is 3-[[1-[[(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperidin-4-yl]methyl]-1H-pyridin-2-one.
| Compound Name | 3-[[1-[[(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperidin-4-yl]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142637516 |
| Molecular Formula | C27H27ClN2O |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 3-[[1-[[(1R,8S)-4-chloro-1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9,11,13-hexaenyl]methyl]piperidin-4-yl]methyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1CC1CCN(C[C@]23C[C@@H](c4ccccc42)c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C27H27ClN2O/c28-20-7-8-22-23-16-27(25(22)15-20,24-6-2-1-5-21(23)24)17-30-12-9-18(10-13-30)14-19-4-3-11-29-26(19)31/h1-8,11,15,18,23H,9-10,12-14,16-17H2,(H,29,31)/t23-,27+/m0/s1 |
| InChIKey | RUGKKMPAGMRECE-WNCULLNHSA-N |
| XLogP | 5.12 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |