C32H48O4SSi — CID 142638041
[6-[5-(benzenesulfinyl)-7-[tert-butyl(dimethyl)silyl]oxy-6-methylhepta-3,4-dien-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate (PubChem CID 142638041) has the molecular formula C32H48O4SSi and a molecular weight of 556.89 g/mol. Its IUPAC name is [6-[5-(benzenesulfinyl)-7-[tert-butyl(dimethyl)silyl]oxy-6-methylhepta-3,4-dien-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate.
| Compound Name | [6-[5-(benzenesulfinyl)-7-[tert-butyl(dimethyl)silyl]oxy-6-methylhepta-3,4-dien-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 142638041 |
| Molecular Formula | C32H48O4SSi |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | [6-[5-(benzenesulfinyl)-7-[tert-butyl(dimethyl)silyl]oxy-6-methylhepta-3,4-dien-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate |
| SMILES | CC(=O)OC1CC(C(C)C=C=C(C(C)CO[Si](C)(C)C(C)(C)C)S(=O)c2ccccc2)CC2(C)C=CCC12 |
| InChI | InChI=1S/C32H48O4SSi/c1-23(26-20-29(36-25(3)33)28-16-13-19-32(28,7)21-26)17-18-30(37(34)27-14-11-10-12-15-27)24(2)22-35-38(8,9)31(4,5)6/h10-15,17,19,23-24,26,28-29H,16,20-22H2,1-9H3 |
| InChIKey | JRLCNRMJWMMWCI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|