About 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine
4-(1H-1,2,4-triazol-5-yl)-2H-oxazine (PubChem CID 142638093) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine |
| PubChem CID | 142638093 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine |
| SMILES | C1=CC(c2ncn[nH]2)=CNO1 |
| InChI | InChI=1S/C6H6N4O/c1-2-11-9-3-5(1)6-7-4-8-10-6/h1-4,9H,(H,7,8,10) |
| InChIKey | PFSHLYHNJLZKQW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine?
The IUPAC name of 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine (CID 142638093) is 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine is C1=CC(c2ncn[nH]2)=CNO1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine?
The InChIKey is PFSHLYHNJLZKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-2-11-9-3-5(1)6-7-4-8-10-6/h1-4,9H,(H,7,8,10).
What are the key properties of 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine?
4-(1H-1,2,4-triazol-5-yl)-2H-oxazine has a molecular weight of 150.14 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-yl)-2H-oxazine is sourced from PubChem (CID 142638093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).