About 2-(iodomethoxy)acetamide
2-(iodomethoxy)acetamide (PubChem CID 142638217) has the molecular formula C3H6INO2
and a molecular weight of 214.99 g/mol. Its IUPAC name is 2-(iodomethoxy)acetamide.
Molecular Properties
| Compound Name | 2-(iodomethoxy)acetamide |
| PubChem CID | 142638217 |
| Molecular Formula | C3H6INO2 |
| Molecular Weight | 214.99 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 2-(iodomethoxy)acetamide |
| SMILES | NC(=O)COCI |
| InChI | InChI=1S/C3H6INO2/c4-2-7-1-3(5)6/h1-2H2,(H2,5,6) |
| InChIKey | IVLQSHFKKSVRID-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.99 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethoxy)acetamide?
The IUPAC name of 2-(iodomethoxy)acetamide (CID 142638217) is 2-(iodomethoxy)acetamide.
What is the SMILES notation for 2-(iodomethoxy)acetamide?
The canonical SMILES for 2-(iodomethoxy)acetamide is NC(=O)COCI.
What is the InChIKey of 2-(iodomethoxy)acetamide?
The InChIKey is IVLQSHFKKSVRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6INO2/c4-2-7-1-3(5)6/h1-2H2,(H2,5,6).
What are the key properties of 2-(iodomethoxy)acetamide?
2-(iodomethoxy)acetamide has a molecular weight of 214.99 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethoxy)acetamide is sourced from PubChem (CID 142638217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).