C31H42N4O — CID 142638286
[5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]-pyridin-3-ylmethanone (PubChem CID 142638286) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is [5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 142638286 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | [5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]-pyridin-3-ylmethanone |
| SMILES | CC(C)C1CCC(N2CCC3(CC2)C2CN(C(=O)c4cccnc4)CC2CN3c2ccccc2)CC1 |
| InChI | InChI=1S/C31H42N4O/c1-23(2)24-10-12-27(13-11-24)33-17-14-31(15-18-33)29-22-34(30(36)25-7-6-16-32-19-25)20-26(29)21-35(31)28-8-4-3-5-9-28/h3-9,16,19,23-24,26-27,29H,10-15,17-18,20-22H2,1-2H3 |
| InChIKey | SCXWNYVOFLLCST-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |