C22H14Cl2O4S — CID 142639106
3-(2,6-dichlorophenyl)-2-(4-methylsulfonylphenyl)chromen-4-one (PubChem CID 142639106) has the molecular formula C22H14Cl2O4S and a molecular weight of 445.32 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-(4-methylsulfonylphenyl)chromen-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-2-(4-methylsulfonylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 142639106 |
| Molecular Formula | C22H14Cl2O4S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-(4-methylsulfonylphenyl)chromen-4-one |
| SMILES | CS(=O)(=O)c1ccc(-c2oc3ccccc3c(=O)c2-c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2O4S/c1-29(26,27)14-11-9-13(10-12-14)22-20(19-16(23)6-4-7-17(19)24)21(25)15-5-2-3-8-18(15)28-22/h2-12H,1H3 |
| InChIKey | IEUVPBZBZGOUHD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |