About 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol
5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol (PubChem CID 142639746) has the molecular formula C12H12FNO2S
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol.
Molecular Properties
| Compound Name | 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol |
| PubChem CID | 142639746 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol |
| SMILES | Oc1cc(F)ccc1OCCCc1cscn1 |
| InChI | InChI=1S/C12H12FNO2S/c13-9-3-4-12(11(15)6-9)16-5-1-2-10-7-17-8-14-10/h3-4,6-8,15H,1-2,5H2 |
| InChIKey | DJMBWBWACMIMQQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol?
The IUPAC name of 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol (CID 142639746) is 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol.
What is the SMILES notation for 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol?
The canonical SMILES for 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol is Oc1cc(F)ccc1OCCCc1cscn1.
What is the InChIKey of 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol?
The InChIKey is DJMBWBWACMIMQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2S/c13-9-3-4-12(11(15)6-9)16-5-1-2-10-7-17-8-14-10/h3-4,6-8,15H,1-2,5H2.
What are the key properties of 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol?
5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol has a molecular weight of 253.30 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[3-(1,3-thiazol-4-yl)propoxy]phenol is sourced from PubChem (CID 142639746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).