About 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol
5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol (PubChem CID 142639753) has the molecular formula C11H10FNO2S
and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol.
Molecular Properties
| Compound Name | 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol |
| PubChem CID | 142639753 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol |
| SMILES | CC(Oc1ccc(F)cc1O)c1cscn1 |
| InChI | InChI=1S/C11H10FNO2S/c1-7(9-5-16-6-13-9)15-11-3-2-8(12)4-10(11)14/h2-7,14H,1H3 |
| InChIKey | HAIKQDSXMDVQSS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol?
The IUPAC name of 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol (CID 142639753) is 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol.
What is the SMILES notation for 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol?
The canonical SMILES for 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol is CC(Oc1ccc(F)cc1O)c1cscn1.
What is the InChIKey of 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol?
The InChIKey is HAIKQDSXMDVQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2S/c1-7(9-5-16-6-13-9)15-11-3-2-8(12)4-10(11)14/h2-7,14H,1H3.
What are the key properties of 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol?
5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol has a molecular weight of 239.27 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[1-(1,3-thiazol-4-yl)ethoxy]phenol is sourced from PubChem (CID 142639753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).