About 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol
2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol (PubChem CID 142639754) has the molecular formula C11H10FNO2S
and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol |
| PubChem CID | 142639754 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol |
| SMILES | OC(COc1ccc(F)cc1)c1cscn1 |
| InChI | InChI=1S/C11H10FNO2S/c12-8-1-3-9(4-2-8)15-5-11(14)10-6-16-7-13-10/h1-4,6-7,11,14H,5H2 |
| InChIKey | KWLHYRSXFSIHFL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol?
The IUPAC name of 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol (CID 142639754) is 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol.
What is the SMILES notation for 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol?
The canonical SMILES for 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol is OC(COc1ccc(F)cc1)c1cscn1.
What is the InChIKey of 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol?
The InChIKey is KWLHYRSXFSIHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2S/c12-8-1-3-9(4-2-8)15-5-11(14)10-6-16-7-13-10/h1-4,6-7,11,14H,5H2.
What are the key properties of 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol?
2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol has a molecular weight of 239.27 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenoxy)-1-(1,3-thiazol-4-yl)ethanol is sourced from PubChem (CID 142639754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).