C23H22ClN3OS — CID 142639797
5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-2-methylsulfanyl-1,3-dihydro-1,2,4-benzotriazepine (PubChem CID 142639797) has the molecular formula C23H22ClN3OS and a molecular weight of 423.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-2-methylsulfanyl-1,3-dihydro-1,2,4-benzotriazepine.
| Compound Name | 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-2-methylsulfanyl-1,3-dihydro-1,2,4-benzotriazepine |
|---|---|
| PubChem CID | 142639797 |
| Molecular Formula | C23H22ClN3OS |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-2-methylsulfanyl-1,3-dihydro-1,2,4-benzotriazepine |
| SMILES | COc1ccc(CC2N=C(c3ccc(Cl)cc3)c3ccccc3NN2SC)cc1 |
| InChI | InChI=1S/C23H22ClN3OS/c1-28-19-13-7-16(8-14-19)15-22-25-23(17-9-11-18(24)12-10-17)20-5-3-4-6-21(20)26-27(22)29-2/h3-14,22,26H,15H2,1-2H3 |
| InChIKey | NEOKICBOHUFFNN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|