C23H17ClN6O2 — CID 142639803
6-(4-chlorophenyl)-1-methyl-4-[nitro(phenyl)methyl]-[1,2,4]triazolo[4,3-a][1,3,4]benzotriazepine (PubChem CID 142639803) has the molecular formula C23H17ClN6O2 and a molecular weight of 444.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-methyl-4-[nitro(phenyl)methyl]-[1,2,4]triazolo[4,3-a][1,3,4]benzotriazepine.
| Compound Name | 6-(4-chlorophenyl)-1-methyl-4-[nitro(phenyl)methyl]-[1,2,4]triazolo[4,3-a][1,3,4]benzotriazepine |
|---|---|
| PubChem CID | 142639803 |
| Molecular Formula | C23H17ClN6O2 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 6-(4-chlorophenyl)-1-methyl-4-[nitro(phenyl)methyl]-[1,2,4]triazolo[4,3-a][1,3,4]benzotriazepine |
| SMILES | Cc1nnc2n1-c1ccccc1C(c1ccc(Cl)cc1)=NN2C(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H17ClN6O2/c1-15-25-26-23-28(15)20-10-6-5-9-19(20)21(16-11-13-18(24)14-12-16)27-29(23)22(30(31)32)17-7-3-2-4-8-17/h2-14,22H,1H3 |
| InChIKey | KEHVPQJTBJDUOE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|