C23H24N4 — CID 142640549
1-(1,2-dihydroacenaphthylen-3-yl)-3-(2,3-dihydroindol-1-yl)-1,3-dimethylguanidine (PubChem CID 142640549) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-3-yl)-3-(2,3-dihydroindol-1-yl)-1,3-dimethylguanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-3-yl)-3-(2,3-dihydroindol-1-yl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 142640549 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-3-yl)-3-(2,3-dihydroindol-1-yl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(/N(C)c1ccc2cccc3c2c1CC3)N(C)N1CCc2ccccc21 |
| InChI | InChI=1S/C23H24N4/c1-25(21-13-11-18-8-5-7-17-10-12-19(21)22(17)18)23(24)26(2)27-15-14-16-6-3-4-9-20(16)27/h3-9,11,13,24H,10,12,14-15H2,1-2H3/b24-23- |
| InChIKey | CLANXPKVXCRMKU-VHXPQNKSSA-N |
| XLogP | 4.22 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|