C24H34O5 — CID 14264068
[(1S,2R,3R,5R)-5-acetyloxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1R,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl]methyl acetate (PubChem CID 14264068) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1S,2R,3R,5R)-5-acetyloxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1R,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl]methyl acetate.
| Compound Name | [(1S,2R,3R,5R)-5-acetyloxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1R,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 14264068 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(1S,2R,3R,5R)-5-acetyloxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1R,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]2C(=O)C=C[C@H]2C)[C@H](/C(C)=C\CC=C(C)C)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H34O5/c1-14(2)8-7-9-15(3)19-12-22(29-18(6)26)20(13-28-17(5)25)24(19)23-16(4)10-11-21(23)27/h8-11,16,19-20,22-24H,7,12-13H2,1-6H3/b15-9-/t16-,19+,20+,22-,23+,24-/m1/s1 |
| InChIKey | HFGVWWLMUPWMCM-DCXMRNKQSA-N |
| XLogP | 4.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|