C16H16N2 — CID 142640932
3-(2,4,6-trimethylphenyl)-1H-pyrrolo[3,2-b]pyridine (PubChem CID 142640932) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2,4,6-trimethylphenyl)-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 3-(2,4,6-trimethylphenyl)-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 142640932 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(2,4,6-trimethylphenyl)-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Cc1cc(C)c(-c2c[nH]c3cccnc23)c(C)c1 |
| InChI | InChI=1S/C16H16N2/c1-10-7-11(2)15(12(3)8-10)13-9-18-14-5-4-6-17-16(13)14/h4-9,18H,1-3H3 |
| InChIKey | NZJSQMNVPVICEO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |