C24H40O5 — CID 14264160
[(1R,4aR,4bS,7R,8R,8aS,10aR)-8-acetyloxy-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 14264160) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is [(1R,4aR,4bS,7R,8R,8aS,10aR)-8-acetyloxy-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aR,4bS,7R,8R,8aS,10aR)-8-acetyloxy-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 14264160 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(1R,4aR,4bS,7R,8R,8aS,10aR)-8-acetyloxy-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)CCC[C@]2(C)[C@H]3CC[C@](C)(CCO)[C@H](OC(C)=O)[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C24H40O5/c1-16(26)28-15-23(4)10-6-11-24(5)19-9-12-22(3,13-14-25)21(29-17(2)27)18(19)7-8-20(23)24/h18-21,25H,6-15H2,1-5H3/t18-,19-,20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | BKQJMYSUUGYYOJ-LWEXMRFPSA-N |
| XLogP | 4.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |