4-amino-3-chloronaphthalene-1,8-dicarboxylic acid

C12H8ClNO4 — CID 142641737

IUPAC4-amino-3-chloronaphthalene-1,8-dicarboxylic acid
SMILESNc1c(Cl)cc(C(=O)O)c2c(C(=O)O)cccc12
InChIInChI=1S/C12H8ClNO4/c13-8-4-7(12(17)18)9-5(10(8)14)2-1-3-6(9)11(15)16/h1-4H,14H2,(H,15,16)(H,17,18)
InChIKeyBSMVFNFOTQGPNU-UHFFFAOYSA-N
MW265.65 g/mol
LogP2.47
Rot. Bonds2

About 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid

4-amino-3-chloronaphthalene-1,8-dicarboxylic acid (PubChem CID 142641737) has the molecular formula C12H8ClNO4 and a molecular weight of 265.65 g/mol. Its IUPAC name is 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid.

Molecular Properties

Compound Name4-amino-3-chloronaphthalene-1,8-dicarboxylic acid
PubChem CID142641737
Molecular FormulaC12H8ClNO4
Molecular Weight265.65 g/mol
Exact Mass265.01
IUPAC Name4-amino-3-chloronaphthalene-1,8-dicarboxylic acid
SMILESNc1c(Cl)cc(C(=O)O)c2c(C(=O)O)cccc12
InChIInChI=1S/C12H8ClNO4/c13-8-4-7(12(17)18)9-5(10(8)14)2-1-3-6(9)11(15)16/h1-4H,14H2,(H,15,16)(H,17,18)
InChIKeyBSMVFNFOTQGPNU-UHFFFAOYSA-N
XLogP2.47
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.65
LogP ≤ 52.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid?
The IUPAC name of 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid (CID 142641737) is 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid.
What is the SMILES notation for 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid?
The canonical SMILES for 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid is Nc1c(Cl)cc(C(=O)O)c2c(C(=O)O)cccc12.
What is the InChIKey of 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid?
The InChIKey is BSMVFNFOTQGPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClNO4/c13-8-4-7(12(17)18)9-5(10(8)14)2-1-3-6(9)11(15)16/h1-4H,14H2,(H,15,16)(H,17,18).
What are the key properties of 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid?
4-amino-3-chloronaphthalene-1,8-dicarboxylic acid has a molecular weight of 265.65 g/mol, XLogP of 2.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-chloronaphthalene-1,8-dicarboxylic acid is sourced from PubChem (CID 142641737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).