C14H9ClN4O2S — CID 142642100
12-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride (PubChem CID 142642100) has the molecular formula C14H9ClN4O2S and a molecular weight of 332.77 g/mol. Its IUPAC name is 12-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride.
| Compound Name | 12-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 142642100 |
| Molecular Formula | C14H9ClN4O2S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 12-phenyl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
| SMILES | Cl.O=c1[nH]c(=O)c2sc3ncc(-c4ccccc4)nc3c2[nH]1 |
| InChI | InChI=1S/C14H8N4O2S.ClH/c19-12-11-9(17-14(20)18-12)10-13(21-11)15-6-8(16-10)7-4-2-1-3-5-7;/h1-6H,(H2,17,18,19,20);1H |
| InChIKey | WWHHPXNRXFCQML-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |