About N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine
N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine (PubChem CID 142642961) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine |
| PubChem CID | 142642961 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine |
| SMILES | CCCCCCN(O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-7-8-9-10-11-15(16)14(5,6)12-13(2,3)4/h16H,7-12H2,1-6H3 |
| InChIKey | HQMZFKPNJWJVBR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine?
The IUPAC name of N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine (CID 142642961) is N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine.
What is the SMILES notation for N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine?
The canonical SMILES for N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine is CCCCCCN(O)C(C)(C)CC(C)(C)C.
What is the InChIKey of N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine?
The InChIKey is HQMZFKPNJWJVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO/c1-7-8-9-10-11-15(16)14(5,6)12-13(2,3)4/h16H,7-12H2,1-6H3.
What are the key properties of N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine?
N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine has a molecular weight of 229.41 g/mol, XLogP of 4.47, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-N-(2,4,4-trimethylpentan-2-yl)hydroxylamine is sourced from PubChem (CID 142642961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).