C13H12O — CID 142643573
1,2,4,9-tetrahydrofluoren-3-one (PubChem CID 142643573) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,2,4,9-tetrahydrofluoren-3-one.
| Compound Name | 1,2,4,9-tetrahydrofluoren-3-one |
|---|---|
| PubChem CID | 142643573 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1,2,4,9-tetrahydrofluoren-3-one |
| SMILES | O=C1CCC2=C(C1)c1ccccc1C2 |
| InChI | InChI=1S/C13H12O/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-4H,5-8H2 |
| InChIKey | OOBACQBHSBLUHZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |