C32H42F2N4O4 — CID 142643606
(2S)-N-[1,5-bis(3,3-dimethylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide (PubChem CID 142643606) has the molecular formula C32H42F2N4O4 and a molecular weight of 584.71 g/mol. Its IUPAC name is (2S)-N-[1,5-bis(3,3-dimethylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[1,5-bis(3,3-dimethylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 142643606 |
| Molecular Formula | C32H42F2N4O4 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | (2S)-N-[1,5-bis(3,3-dimethylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)NC1C(=O)N(CCC(C)(C)C)c2ccccc2N(CCC(C)(C)C)C1=O |
| InChI | InChI=1S/C32H42F2N4O4/c1-20(35-26(39)18-21-16-22(33)19-23(34)17-21)28(40)36-27-29(41)37(14-12-31(2,3)4)24-10-8-9-11-25(24)38(30(27)42)15-13-32(5,6)7/h8-11,16-17,19-20,27H,12-15,18H2,1-7H3,(H,35,39)(H,36,40)/t20-/m0/s1 |
| InChIKey | OSDKMZZZUISZFS-FQEVSTJZSA-N |
| XLogP | 4.75 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|