C17H20N2O2 — CID 142643787
6-(2-imidazol-1-ylethoxy)-7-methyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 142643787) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-(2-imidazol-1-ylethoxy)-7-methyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 6-(2-imidazol-1-ylethoxy)-7-methyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 142643787 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 6-(2-imidazol-1-ylethoxy)-7-methyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | Cc1cc2c(cc1OCCn1ccnc1)CCCC2C=O |
| InChI | InChI=1S/C17H20N2O2/c1-13-9-16-14(3-2-4-15(16)11-20)10-17(13)21-8-7-19-6-5-18-12-19/h5-6,9-12,15H,2-4,7-8H2,1H3 |
| InChIKey | YDCXLDGBOHTWAG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|