C17H24O5 — CID 14264444
dipropan-2-yl (2R,3S)-2-benzyl-3-hydroxybutanedioate (PubChem CID 14264444) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is dipropan-2-yl (2R,3S)-2-benzyl-3-hydroxybutanedioate.
| Compound Name | dipropan-2-yl (2R,3S)-2-benzyl-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 14264444 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | dipropan-2-yl (2R,3S)-2-benzyl-3-hydroxybutanedioate |
| SMILES | CC(C)OC(=O)[C@@H](O)[C@@H](Cc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C17H24O5/c1-11(2)21-16(19)14(10-13-8-6-5-7-9-13)15(18)17(20)22-12(3)4/h5-9,11-12,14-15,18H,10H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | UXEWCDZMYQWTHK-CABCVRRESA-N |
| XLogP | 2.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |