About methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride
methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride (PubChem CID 142646042) has the molecular formula C15H29ClN2O3
and a molecular weight of 320.86 g/mol. Its IUPAC name is methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 142646042 |
| Molecular Formula | C15H29ClN2O3 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1(CCC(C)C(C)NC(C)=O)CCC(N)C1.Cl |
| InChI | InChI=1S/C15H28N2O3.ClH/c1-10(11(2)17-12(3)18)5-7-15(14(19)20-4)8-6-13(16)9-15;/h10-11,13H,5-9,16H2,1-4H3,(H,17,18);1H |
| InChIKey | OMIKAIOPIGHCFI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride (CID 142646042) is methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride is COC(=O)C1(CCC(C)C(C)NC(C)=O)CCC(N)C1.Cl.
What is the InChIKey of methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride?
The InChIKey is OMIKAIOPIGHCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3.ClH/c1-10(11(2)17-12(3)18)5-7-15(14(19)20-4)8-6-13(16)9-15;/h10-11,13H,5-9,16H2,1-4H3,(H,17,18);1H.
What are the key properties of methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride?
methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride has a molecular weight of 320.86 g/mol, XLogP of 2.02, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-acetamido-3-methylpentyl)-3-aminocyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 142646042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).