About 1-decan-5-yl-2H-pyrazine
1-decan-5-yl-2H-pyrazine (PubChem CID 142646115) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-decan-5-yl-2H-pyrazine.
Molecular Properties
| Compound Name | 1-decan-5-yl-2H-pyrazine |
| PubChem CID | 142646115 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-decan-5-yl-2H-pyrazine |
| SMILES | CCCCCC(CCCC)N1C=CN=CC1 |
| InChI | InChI=1S/C14H26N2/c1-3-5-7-9-14(8-6-4-2)16-12-10-15-11-13-16/h10-12,14H,3-9,13H2,1-2H3 |
| InChIKey | HNAYRYKWTOCKTH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decan-5-yl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decan-5-yl-2H-pyrazine?
The IUPAC name of 1-decan-5-yl-2H-pyrazine (CID 142646115) is 1-decan-5-yl-2H-pyrazine.
What is the SMILES notation for 1-decan-5-yl-2H-pyrazine?
The canonical SMILES for 1-decan-5-yl-2H-pyrazine is CCCCCC(CCCC)N1C=CN=CC1.
What is the InChIKey of 1-decan-5-yl-2H-pyrazine?
The InChIKey is HNAYRYKWTOCKTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-3-5-7-9-14(8-6-4-2)16-12-10-15-11-13-16/h10-12,14H,3-9,13H2,1-2H3.
What are the key properties of 1-decan-5-yl-2H-pyrazine?
1-decan-5-yl-2H-pyrazine has a molecular weight of 222.38 g/mol, XLogP of 3.98, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decan-5-yl-2H-pyrazine is sourced from PubChem (CID 142646115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).