About 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide
4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide (PubChem CID 142647446) has the molecular formula C13H18N2O4S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide.
Molecular Properties
| Compound Name | 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide |
| PubChem CID | 142647446 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNC2CCCC(=O)C2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-19-12-5-7-13(8-6-12)20(17,18)15-14-10-3-2-4-11(16)9-10/h5-8,10,14-15H,2-4,9H2,1H3 |
| InChIKey | BFCQZWCMFJMOIY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide?
The IUPAC name of 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide (CID 142647446) is 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide.
What is the SMILES notation for 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide?
The canonical SMILES for 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide is COc1ccc(S(=O)(=O)NNC2CCCC(=O)C2)cc1.
What is the InChIKey of 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide?
The InChIKey is BFCQZWCMFJMOIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S/c1-19-12-5-7-13(8-6-12)20(17,18)15-14-10-3-2-4-11(16)9-10/h5-8,10,14-15H,2-4,9H2,1H3.
What are the key properties of 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide?
4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide has a molecular weight of 298.36 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N'-(3-oxocyclohexyl)benzenesulfonohydrazide is sourced from PubChem (CID 142647446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).