C8H12N4O3 — CID 142647678
2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanamide (PubChem CID 142647678) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanamide.
| Compound Name | 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanamide |
|---|---|
| PubChem CID | 142647678 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanamide |
| SMILES | NC(=O)C(N)CCn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C8H12N4O3/c9-5(7(10)14)2-4-12-6(13)1-3-11-8(12)15/h1,3,5H,2,4,9H2,(H2,10,14)(H,11,15) |
| InChIKey | AJYHUNGFVOIMCP-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |