C13H20O2 — CID 1426479
(1R,2R,7R,9S)-2-hydroxytricyclo[7.3.1.02,7]tridecan-13-one (PubChem CID 1426479) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2R,7R,9S)-2-hydroxytricyclo[7.3.1.02,7]tridecan-13-one.
| Compound Name | (1R,2R,7R,9S)-2-hydroxytricyclo[7.3.1.02,7]tridecan-13-one |
|---|---|
| PubChem CID | 1426479 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2R,7R,9S)-2-hydroxytricyclo[7.3.1.02,7]tridecan-13-one |
| SMILES | O=C1[C@H]2CCC[C@@H]1[C@@]1(O)CCCC[C@@H]1C2 |
| InChI | InChI=1S/C13H20O2/c14-12-9-4-3-6-11(12)13(15)7-2-1-5-10(13)8-9/h9-11,15H,1-8H2/t9-,10+,11-,13+/m0/s1 |
| InChIKey | PDLKQXJZJXLNBA-SRRSOLGSSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |