C17H16ClF3N4O6S2 — CID 142647927
(2R)-N-[2-chloro-4-[4-(diaminomethylideneamino)sulfonylphenyl]sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (PubChem CID 142647927) has the molecular formula C17H16ClF3N4O6S2 and a molecular weight of 528.92 g/mol. Its IUPAC name is (2R)-N-[2-chloro-4-[4-(diaminomethylideneamino)sulfonylphenyl]sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide.
| Compound Name | (2R)-N-[2-chloro-4-[4-(diaminomethylideneamino)sulfonylphenyl]sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 142647927 |
| Molecular Formula | C17H16ClF3N4O6S2 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | (2R)-N-[2-chloro-4-[4-(diaminomethylideneamino)sulfonylphenyl]sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@@](O)(C(=O)Nc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)N=C(N)N)cc2)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C17H16ClF3N4O6S2/c1-16(27,17(19,20)21)14(26)24-13-7-6-11(8-12(13)18)32(28,29)9-2-4-10(5-3-9)33(30,31)25-15(22)23/h2-8,27H,1H3,(H,24,26)(H4,22,23,25)/t16-/m1/s1 |
| InChIKey | ONQVCEHVIJINIT-MRXNPFEDSA-N |
| XLogP | 1.39 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|