C21H34F6O3Si — CID 142648149
12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoic acid (PubChem CID 142648149) has the molecular formula C21H34F6O3Si and a molecular weight of 476.57 g/mol. Its IUPAC name is 12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoic acid.
| Compound Name | 12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoic acid |
|---|---|
| PubChem CID | 142648149 |
| Molecular Formula | C21H34F6O3Si |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoic acid |
| SMILES | CC[Si](CC)(CC)OC(C=CCC(C)(C)CCCC=CC(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H34F6O3Si/c1-6-31(7-2,8-3)30-19(20(22,23)24,21(25,26)27)16-12-15-18(4,5)14-11-9-10-13-17(28)29/h10,12-13,16H,6-9,11,14-15H2,1-5H3,(H,28,29) |
| InChIKey | XIAMMTCCBKTTBG-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|