About 5-methoxy-2-(1,3,5-triazin-2-yl)phenol
5-methoxy-2-(1,3,5-triazin-2-yl)phenol (PubChem CID 142648649) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-methoxy-2-(1,3,5-triazin-2-yl)phenol.
Molecular Properties
| Compound Name | 5-methoxy-2-(1,3,5-triazin-2-yl)phenol |
| PubChem CID | 142648649 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-methoxy-2-(1,3,5-triazin-2-yl)phenol |
| SMILES | COc1ccc(-c2ncncn2)c(O)c1 |
| InChI | InChI=1S/C10H9N3O2/c1-15-7-2-3-8(9(14)4-7)10-12-5-11-6-13-10/h2-6,14H,1H3 |
| InChIKey | SODLLMREPICYOF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2-(1,3,5-triazin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-(1,3,5-triazin-2-yl)phenol?
The IUPAC name of 5-methoxy-2-(1,3,5-triazin-2-yl)phenol (CID 142648649) is 5-methoxy-2-(1,3,5-triazin-2-yl)phenol.
What is the SMILES notation for 5-methoxy-2-(1,3,5-triazin-2-yl)phenol?
The canonical SMILES for 5-methoxy-2-(1,3,5-triazin-2-yl)phenol is COc1ccc(-c2ncncn2)c(O)c1.
What is the InChIKey of 5-methoxy-2-(1,3,5-triazin-2-yl)phenol?
The InChIKey is SODLLMREPICYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-15-7-2-3-8(9(14)4-7)10-12-5-11-6-13-10/h2-6,14H,1H3.
What are the key properties of 5-methoxy-2-(1,3,5-triazin-2-yl)phenol?
5-methoxy-2-(1,3,5-triazin-2-yl)phenol has a molecular weight of 203.20 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-(1,3,5-triazin-2-yl)phenol is sourced from PubChem (CID 142648649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).