C19H26BrN5O4S — CID 142649052
[4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 142649052) has the molecular formula C19H26BrN5O4S and a molecular weight of 500.42 g/mol. Its IUPAC name is [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 142649052 |
| Molecular Formula | C19H26BrN5O4S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [4-(7-bromo-5-butylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CCCCSc1nc(Br)c2nnn(C3CC(COC(C)=O)C4OC(C)(C)OC43)c2n1 |
| InChI | InChI=1S/C19H26BrN5O4S/c1-5-6-7-30-18-21-16(20)13-17(22-18)25(24-23-13)12-8-11(9-27-10(2)26)14-15(12)29-19(3,4)28-14/h11-12,14-15H,5-9H2,1-4H3 |
| InChIKey | GZDSJUHATVWWIE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|