C8H10N2O6 — CID 142649290
[3,4-dihydroxy-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl] formate (PubChem CID 142649290) has the molecular formula C8H10N2O6 and a molecular weight of 230.18 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl] formate.
| Compound Name | [3,4-dihydroxy-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl] formate |
|---|---|
| PubChem CID | 142649290 |
| Molecular Formula | C8H10N2O6 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | [3,4-dihydroxy-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl] formate |
| SMILES | Cc1noc(C2OC(OC=O)C(O)C2O)n1 |
| InChI | InChI=1S/C8H10N2O6/c1-3-9-7(16-10-3)6-4(12)5(13)8(15-6)14-2-11/h2,4-6,8,12-13H,1H3 |
| InChIKey | XEYQSJAAXQAHTI-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|