C12H15BrNO4PS — CID 142649801
6-bromo-4-(diethoxyphosphorylmethoxy)-1,3-benzothiazole (PubChem CID 142649801) has the molecular formula C12H15BrNO4PS and a molecular weight of 380.20 g/mol. Its IUPAC name is 6-bromo-4-(diethoxyphosphorylmethoxy)-1,3-benzothiazole.
| Compound Name | 6-bromo-4-(diethoxyphosphorylmethoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 142649801 |
| Molecular Formula | C12H15BrNO4PS |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 6-bromo-4-(diethoxyphosphorylmethoxy)-1,3-benzothiazole |
| SMILES | CCOP(=O)(COc1cc(Br)cc2scnc12)OCC |
| InChI | InChI=1S/C12H15BrNO4PS/c1-3-17-19(15,18-4-2)8-16-10-5-9(13)6-11-12(10)14-7-20-11/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | ATVKFSLREQZWLV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|