C14H10F3NS — CID 142649869
2-thiophen-2-yl-5-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 142649869) has the molecular formula C14H10F3NS and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-thiophen-2-yl-5-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-thiophen-2-yl-5-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142649869 |
| Molecular Formula | C14H10F3NS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-thiophen-2-yl-5-(2,3,4-trifluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1ccc(C2=NC(c3cccs3)CC2)c(F)c1F |
| InChI | InChI=1S/C14H10F3NS/c15-9-4-3-8(13(16)14(9)17)10-5-6-11(18-10)12-2-1-7-19-12/h1-4,7,11H,5-6H2 |
| InChIKey | VEZZBKJEBNHOKE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|