C14H17NO2 — CID 14265020
6,7-dimethoxy-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 14265020) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 6,7-dimethoxy-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 6,7-dimethoxy-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 14265020 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 6,7-dimethoxy-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1cc2[nH]c3c(c2cc1OC)CCCC3 |
| InChI | InChI=1S/C14H17NO2/c1-16-13-7-10-9-5-3-4-6-11(9)15-12(10)8-14(13)17-2/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | CUEQVFQQHAVXGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|