About 2-ethenoxyethylthiourea
2-ethenoxyethylthiourea (PubChem CID 14265028) has the molecular formula C5H10N2OS
and a molecular weight of 146.22 g/mol. Its IUPAC name is 2-ethenoxyethylthiourea.
Molecular Properties
| Compound Name | 2-ethenoxyethylthiourea |
| PubChem CID | 14265028 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2-ethenoxyethylthiourea |
| SMILES | C=COCCNC(N)=S |
| InChI | InChI=1S/C5H10N2OS/c1-2-8-4-3-7-5(6)9/h2H,1,3-4H2,(H3,6,7,9) |
| InChIKey | PIWYHCQFPVMWJP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxyethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxyethylthiourea?
The IUPAC name of 2-ethenoxyethylthiourea (CID 14265028) is 2-ethenoxyethylthiourea.
What is the SMILES notation for 2-ethenoxyethylthiourea?
The canonical SMILES for 2-ethenoxyethylthiourea is C=COCCNC(N)=S.
What is the InChIKey of 2-ethenoxyethylthiourea?
The InChIKey is PIWYHCQFPVMWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2OS/c1-2-8-4-3-7-5(6)9/h2H,1,3-4H2,(H3,6,7,9).
What are the key properties of 2-ethenoxyethylthiourea?
2-ethenoxyethylthiourea has a molecular weight of 146.22 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxyethylthiourea is sourced from PubChem (CID 14265028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).