C28H36N2O5 — CID 142651180
3,3-diethyl-5-[4-(4-methoxyphenyl)phenyl]-2-(4-methylpiperazine-1-carbonyl)-5-oxopentanoic acid (PubChem CID 142651180) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 3,3-diethyl-5-[4-(4-methoxyphenyl)phenyl]-2-(4-methylpiperazine-1-carbonyl)-5-oxopentanoic acid.
| Compound Name | 3,3-diethyl-5-[4-(4-methoxyphenyl)phenyl]-2-(4-methylpiperazine-1-carbonyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142651180 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 3,3-diethyl-5-[4-(4-methoxyphenyl)phenyl]-2-(4-methylpiperazine-1-carbonyl)-5-oxopentanoic acid |
| SMILES | CCC(CC)(CC(=O)c1ccc(-c2ccc(OC)cc2)cc1)C(C(=O)O)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H36N2O5/c1-5-28(6-2,25(27(33)34)26(32)30-17-15-29(3)16-18-30)19-24(31)22-9-7-20(8-10-22)21-11-13-23(35-4)14-12-21/h7-14,25H,5-6,15-19H2,1-4H3,(H,33,34) |
| InChIKey | QOKRWHCEZXVAOD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|