C22H27N2+ — CID 1426513
(2R)-5-benzyl-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium (PubChem CID 1426513) has the molecular formula C22H27N2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is (2R)-5-benzyl-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium.
| Compound Name | (2R)-5-benzyl-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 1426513 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | (2R)-5-benzyl-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-ium |
| SMILES | CC(C)[N@+]1(C)CCc2c(c3ccccc3n2Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N2/c1-17(2)24(3)14-13-22-20(16-24)19-11-7-8-12-21(19)23(22)15-18-9-5-4-6-10-18/h4-12,17H,13-16H2,1-3H3/q+1/t24-/m1/s1 |
| InChIKey | DZUCQBYWBBOHDD-XMMPIXPASA-N |
| XLogP | 4.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|