C30H32Cl2N2O3S — CID 142651325
7a-[(2S)-2-(3,4-dichlorophenyl)-4-[4-[2-[(S)-methylsulfinyl]phenyl]piperidin-1-yl]butyl]-3aH-isoindole-1,3-dione (PubChem CID 142651325) has the molecular formula C30H32Cl2N2O3S and a molecular weight of 571.57 g/mol. Its IUPAC name is 7a-[(2S)-2-(3,4-dichlorophenyl)-4-[4-[2-[(S)-methylsulfinyl]phenyl]piperidin-1-yl]butyl]-3aH-isoindole-1,3-dione.
| Compound Name | 7a-[(2S)-2-(3,4-dichlorophenyl)-4-[4-[2-[(S)-methylsulfinyl]phenyl]piperidin-1-yl]butyl]-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 142651325 |
| Molecular Formula | C30H32Cl2N2O3S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 7a-[(2S)-2-(3,4-dichlorophenyl)-4-[4-[2-[(S)-methylsulfinyl]phenyl]piperidin-1-yl]butyl]-3aH-isoindole-1,3-dione |
| SMILES | C[S@](=O)c1ccccc1C1CCN(CC[C@H](CC23C=CC=CC2C(=O)NC3=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C30H32Cl2N2O3S/c1-38(37)27-8-3-2-6-23(27)20-11-15-34(16-12-20)17-13-22(21-9-10-25(31)26(32)18-21)19-30-14-5-4-7-24(30)28(35)33-29(30)36/h2-10,14,18,20,22,24H,11-13,15-17,19H2,1H3,(H,33,35,36)/t22-,24?,30?,38+/m1/s1 |
| InChIKey | KIFSDWRZMYAZRF-AKBRQZJXSA-N |
| XLogP | 5.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|