C11H17Cl2N3 — CID 142652132
2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline;dihydrochloride (PubChem CID 142652132) has the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline;dihydrochloride.
| Compound Name | 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline;dihydrochloride |
|---|---|
| PubChem CID | 142652132 |
| Molecular Formula | C11H17Cl2N3 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)NCC1CNCCN21 |
| InChI | InChI=1S/C11H15N3.2ClH/c1-2-4-11-10(3-1)13-8-9-7-12-5-6-14(9)11;;/h1-4,9,12-13H,5-8H2;2*1H |
| InChIKey | YNYCTOULRPHNTH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |