C7H10N2O3 — CID 142652199
6-methoxy-6-nitrocyclohexa-2,4-dien-1-amine (PubChem CID 142652199) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 6-methoxy-6-nitrocyclohexa-2,4-dien-1-amine.
| Compound Name | 6-methoxy-6-nitrocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142652199 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 6-methoxy-6-nitrocyclohexa-2,4-dien-1-amine |
| SMILES | COC1([N+](=O)[O-])C=CC=CC1N |
| InChI | InChI=1S/C7H10N2O3/c1-12-7(9(10)11)5-3-2-4-6(7)8/h2-6H,8H2,1H3 |
| InChIKey | LGUNJGDLNFXDBD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|