C11H10N6O4 — CID 142652243
N-(5-ethyl-1,3-oxazol-2-yl)-2,6-dioxo-3H-purine-9-carboxamide (PubChem CID 142652243) has the molecular formula C11H10N6O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-(5-ethyl-1,3-oxazol-2-yl)-2,6-dioxo-3H-purine-9-carboxamide.
| Compound Name | N-(5-ethyl-1,3-oxazol-2-yl)-2,6-dioxo-3H-purine-9-carboxamide |
|---|---|
| PubChem CID | 142652243 |
| Molecular Formula | C11H10N6O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(5-ethyl-1,3-oxazol-2-yl)-2,6-dioxo-3H-purine-9-carboxamide |
| SMILES | CCc1cnc(NC(=O)n2cnc3c(=O)[nH]c(=O)[nH]c32)o1 |
| InChI | InChI=1S/C11H10N6O4/c1-2-5-3-12-10(21-5)16-11(20)17-4-13-6-7(17)14-9(19)15-8(6)18/h3-4H,2H2,1H3,(H,12,16,20)(H2,14,15,18,19) |
| InChIKey | LFYGEGYLOROCBF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |