C13H15N3O — CID 142652454
8-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 142652454) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 8-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 8-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 142652454 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 8-amino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]c3c(c2c1)CCCC3N |
| InChI | InChI=1S/C13H15N3O/c14-10-3-1-2-8-9-6-7(13(15)17)4-5-11(9)16-12(8)10/h4-6,10,16H,1-3,14H2,(H2,15,17) |
| InChIKey | QSNQAZXLDTUXPZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|