C37H60FNO6Si — CID 142652910
13-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxan-4-yl)-14-fluoro-5-hydroxy-2,6,10-trimethyl-15-(2-methyl-1,3-oxazol-4-yl)-4-prop-2-ynylpentadeca-10,14-dien-3-one (PubChem CID 142652910) has the molecular formula C37H60FNO6Si and a molecular weight of 661.97 g/mol. Its IUPAC name is 13-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxan-4-yl)-14-fluoro-5-hydroxy-2,6,10-trimethyl-15-(2-methyl-1,3-oxazol-4-yl)-4-prop-2-ynylpentadeca-10,14-dien-3-one.
| Compound Name | 13-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxan-4-yl)-14-fluoro-5-hydroxy-2,6,10-trimethyl-15-(2-methyl-1,3-oxazol-4-yl)-4-prop-2-ynylpentadeca-10,14-dien-3-one |
|---|---|
| PubChem CID | 142652910 |
| Molecular Formula | C37H60FNO6Si |
| Molecular Weight | 661.97 g/mol |
| Exact Mass | 661.42 |
| IUPAC Name | 13-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxan-4-yl)-14-fluoro-5-hydroxy-2,6,10-trimethyl-15-(2-methyl-1,3-oxazol-4-yl)-4-prop-2-ynylpentadeca-10,14-dien-3-one |
| SMILES | C#CCC(C(=O)C(C)(C)C1CCOC(C)(C)O1)C(O)C(C)CCCC(C)=CCC(O[Si](C)(C)C(C)(C)C)C(F)=Cc1coc(C)n1 |
| InChI | InChI=1S/C37H60FNO6Si/c1-14-16-29(34(41)36(8,9)32-21-22-43-37(10,11)44-32)33(40)26(3)18-15-17-25(2)19-20-31(45-46(12,13)35(5,6)7)30(38)23-28-24-42-27(4)39-28/h1,19,23-24,26,29,31-33,40H,15-18,20-22H2,2-13H3 |
| InChIKey | HXITWSAATZYJTL-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.97 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|