About 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol
6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol (PubChem CID 142653303) has the molecular formula C7H8O2S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol |
| PubChem CID | 142653303 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol |
| SMILES | Oc1cc2c(s1)CCCO2 |
| InChI | InChI=1S/C7H8O2S/c8-7-4-5-6(10-7)2-1-3-9-5/h4,8H,1-3H2 |
| InChIKey | MSZLJAHXIDMCLR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol?
The IUPAC name of 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol (CID 142653303) is 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol.
What is the SMILES notation for 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol?
The canonical SMILES for 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol is Oc1cc2c(s1)CCCO2.
What is the InChIKey of 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol?
The InChIKey is MSZLJAHXIDMCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c8-7-4-5-6(10-7)2-1-3-9-5/h4,8H,1-3H2.
What are the key properties of 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol?
6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol has a molecular weight of 156.21 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-thieno[3,2-b]pyran-2-ol is sourced from PubChem (CID 142653303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).